C23H34N6O — CID 59534284
(2R)-7-amino-2-[[7-(benzylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]heptan-1-ol (PubChem CID 59534284) has the molecular formula C23H34N6O and a molecular weight of 410.57 g/mol. Its IUPAC name is (2R)-7-amino-2-[[7-(benzylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]heptan-1-ol.
| Compound Name | (2R)-7-amino-2-[[7-(benzylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]heptan-1-ol |
|---|---|
| PubChem CID | 59534284 |
| Molecular Formula | C23H34N6O |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | (2R)-7-amino-2-[[7-(benzylamino)-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]heptan-1-ol |
| SMILES | CC(C)c1cnn2c(NCc3ccccc3)cc(N[C@@H](CO)CCCCCN)nc12 |
| InChI | InChI=1S/C23H34N6O/c1-17(2)20-15-26-29-22(25-14-18-9-5-3-6-10-18)13-21(28-23(20)29)27-19(16-30)11-7-4-8-12-24/h3,5-6,9-10,13,15,17,19,25,30H,4,7-8,11-12,14,16,24H2,1-2H3,(H,27,28)/t19-/m1/s1 |
| InChIKey | FUNKDCBNXPEVIP-LJQANCHMSA-N |
| XLogP | 3.76 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|