C20H35NO3Si — CID 59534301
tert-butyl (4R)-2,2-dimethyl-4-[(Z)-7-trimethylsilylhept-1-en-6-ynyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 59534301) has the molecular formula C20H35NO3Si and a molecular weight of 365.59 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[(Z)-7-trimethylsilylhept-1-en-6-ynyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[(Z)-7-trimethylsilylhept-1-en-6-ynyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 59534301 |
| Molecular Formula | C20H35NO3Si |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[(Z)-7-trimethylsilylhept-1-en-6-ynyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](/C=C\CCCC#C[Si](C)(C)C)COC1(C)C |
| InChI | InChI=1S/C20H35NO3Si/c1-19(2,3)24-18(22)21-17(16-23-20(21,4)5)14-12-10-9-11-13-15-25(6,7)8/h12,14,17H,9-11,16H2,1-8H3/b14-12-/t17-/m1/s1 |
| InChIKey | MWZFVBSNHAPAPS-BHEFUSTPSA-N |
| XLogP | 4.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|