C24H23FN4O2S — CID 59534766
3-[8-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]isoquinolin-6-yl]-5-fluorobenzonitrile (PubChem CID 59534766) has the molecular formula C24H23FN4O2S and a molecular weight of 450.54 g/mol. Its IUPAC name is 3-[8-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]isoquinolin-6-yl]-5-fluorobenzonitrile.
| Compound Name | 3-[8-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]isoquinolin-6-yl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 59534766 |
| Molecular Formula | C24H23FN4O2S |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 3-[8-[(1-cyclopropylsulfonylpiperidin-4-yl)amino]isoquinolin-6-yl]-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(-c2cc(NC3CCN(S(=O)(=O)C4CC4)CC3)c3cnccc3c2)c1 |
| InChI | InChI=1S/C24H23FN4O2S/c25-20-10-16(14-26)9-18(12-20)19-11-17-3-6-27-15-23(17)24(13-19)28-21-4-7-29(8-5-21)32(30,31)22-1-2-22/h3,6,9-13,15,21-22,28H,1-2,4-5,7-8H2 |
| InChIKey | HQWLUAFSUXGGCS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |