C25H28N4O2S — CID 59534824
3-[4-[8-[(1-ethylsulfonylpiperidin-4-yl)amino]isoquinolin-6-yl]phenyl]propanenitrile (PubChem CID 59534824) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is 3-[4-[8-[(1-ethylsulfonylpiperidin-4-yl)amino]isoquinolin-6-yl]phenyl]propanenitrile.
| Compound Name | 3-[4-[8-[(1-ethylsulfonylpiperidin-4-yl)amino]isoquinolin-6-yl]phenyl]propanenitrile |
|---|---|
| PubChem CID | 59534824 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 3-[4-[8-[(1-ethylsulfonylpiperidin-4-yl)amino]isoquinolin-6-yl]phenyl]propanenitrile |
| SMILES | CCS(=O)(=O)N1CCC(Nc2cc(-c3ccc(CCC#N)cc3)cc3ccncc23)CC1 |
| InChI | InChI=1S/C25H28N4O2S/c1-2-32(30,31)29-14-10-23(11-15-29)28-25-17-22(16-21-9-13-27-18-24(21)25)20-7-5-19(6-8-20)4-3-12-26/h5-9,13,16-18,23,28H,2-4,10-11,14-15H2,1H3 |
| InChIKey | WABIOYQJMFJNEV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |