C22H29N5O2S — CID 59534836
6-[1-(2-methylpropyl)pyrazol-4-yl]-N-(1-methylsulfonylpiperidin-4-yl)isoquinolin-8-amine (PubChem CID 59534836) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 6-[1-(2-methylpropyl)pyrazol-4-yl]-N-(1-methylsulfonylpiperidin-4-yl)isoquinolin-8-amine.
| Compound Name | 6-[1-(2-methylpropyl)pyrazol-4-yl]-N-(1-methylsulfonylpiperidin-4-yl)isoquinolin-8-amine |
|---|---|
| PubChem CID | 59534836 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 6-[1-(2-methylpropyl)pyrazol-4-yl]-N-(1-methylsulfonylpiperidin-4-yl)isoquinolin-8-amine |
| SMILES | CC(C)Cn1cc(-c2cc(NC3CCN(S(C)(=O)=O)CC3)c3cnccc3c2)cn1 |
| InChI | InChI=1S/C22H29N5O2S/c1-16(2)14-26-15-19(12-24-26)18-10-17-4-7-23-13-21(17)22(11-18)25-20-5-8-27(9-6-20)30(3,28)29/h4,7,10-13,15-16,20,25H,5-6,8-9,14H2,1-3H3 |
| InChIKey | PKGASYCXYFWNFK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |