C24H25N3O4 — CID 59535498
4-[[2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetyl]amino]-N-phenylmethoxybutanamide (PubChem CID 59535498) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 4-[[2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetyl]amino]-N-phenylmethoxybutanamide.
| Compound Name | 4-[[2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetyl]amino]-N-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 59535498 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 4-[[2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetyl]amino]-N-phenylmethoxybutanamide |
| SMILES | O=C(CCCNC(=O)C(=O)c1cn2c3c(cccc13)CCC2)NOCc1ccccc1 |
| InChI | InChI=1S/C24H25N3O4/c28-21(26-31-16-17-7-2-1-3-8-17)12-5-13-25-24(30)23(29)20-15-27-14-6-10-18-9-4-11-19(20)22(18)27/h1-4,7-9,11,15H,5-6,10,12-14,16H2,(H,25,30)(H,26,28) |
| InChIKey | XWIDRNKUIHKNPP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|