C26H29N3O4 — CID 59535499
6-[[2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetyl]amino]-N-phenylmethoxyhexanamide (PubChem CID 59535499) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 6-[[2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetyl]amino]-N-phenylmethoxyhexanamide.
| Compound Name | 6-[[2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetyl]amino]-N-phenylmethoxyhexanamide |
|---|---|
| PubChem CID | 59535499 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 6-[[2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetyl]amino]-N-phenylmethoxyhexanamide |
| SMILES | O=C(CCCCCNC(=O)C(=O)c1cn2c3c(cccc13)CCC2)NOCc1ccccc1 |
| InChI | InChI=1S/C26H29N3O4/c30-23(28-33-18-19-9-3-1-4-10-19)14-5-2-6-15-27-26(32)25(31)22-17-29-16-8-12-20-11-7-13-21(22)24(20)29/h1,3-4,7,9-11,13,17H,2,5-6,8,12,14-16,18H2,(H,27,32)(H,28,30) |
| InChIKey | OYKSVDWIRMVTJS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|