C24H27N3O3 — CID 59535508
N-[5-oxo-5-(phenylmethoxyamino)pentyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-3-carboxamide (PubChem CID 59535508) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[5-oxo-5-(phenylmethoxyamino)pentyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-3-carboxamide.
| Compound Name | N-[5-oxo-5-(phenylmethoxyamino)pentyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 59535508 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[5-oxo-5-(phenylmethoxyamino)pentyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-3-carboxamide |
| SMILES | O=C(CCCCNC(=O)c1cn2c3c(cccc13)CCC2)NOCc1ccccc1 |
| InChI | InChI=1S/C24H27N3O3/c28-22(26-30-17-18-8-2-1-3-9-18)13-4-5-14-25-24(29)21-16-27-15-7-11-19-10-6-12-20(21)23(19)27/h1-3,6,8-10,12,16H,4-5,7,11,13-15,17H2,(H,25,29)(H,26,28) |
| InChIKey | VQYNWQJQRPSEBW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|