C27H25N3O3 — CID 59535512
N-[[4-(phenylmethoxycarbamoyl)phenyl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-3-carboxamide (PubChem CID 59535512) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[[4-(phenylmethoxycarbamoyl)phenyl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-3-carboxamide.
| Compound Name | N-[[4-(phenylmethoxycarbamoyl)phenyl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 59535512 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[[4-(phenylmethoxycarbamoyl)phenyl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-3-carboxamide |
| SMILES | O=C(NOCc1ccccc1)c1ccc(CNC(=O)c2cn3c4c(cccc24)CCC3)cc1 |
| InChI | InChI=1S/C27H25N3O3/c31-26(29-33-18-20-6-2-1-3-7-20)22-13-11-19(12-14-22)16-28-27(32)24-17-30-15-5-9-21-8-4-10-23(24)25(21)30/h1-4,6-8,10-14,17H,5,9,15-16,18H2,(H,28,32)(H,29,31) |
| InChIKey | HCHJXVRTIUBNCF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|