C22H21N7O2 — CID 59535698
12-(1-methylpyrazol-4-yl)-3-pentyl-6-pyrimidin-5-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one (PubChem CID 59535698) has the molecular formula C22H21N7O2 and a molecular weight of 415.46 g/mol. Its IUPAC name is 12-(1-methylpyrazol-4-yl)-3-pentyl-6-pyrimidin-5-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one.
| Compound Name | 12-(1-methylpyrazol-4-yl)-3-pentyl-6-pyrimidin-5-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one |
|---|---|
| PubChem CID | 59535698 |
| Molecular Formula | C22H21N7O2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 12-(1-methylpyrazol-4-yl)-3-pentyl-6-pyrimidin-5-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one |
| SMILES | CCCCCn1c(=O)nc(-c2cncnc2)c2oc3ncc(-c4cnn(C)c4)cc3c21 |
| InChI | InChI=1S/C22H21N7O2/c1-3-4-5-6-29-19-17-7-14(16-11-26-28(2)12-16)10-25-21(17)31-20(19)18(27-22(29)30)15-8-23-13-24-9-15/h7-13H,3-6H2,1-2H3 |
| InChIKey | VSRMSOYTFJVXNU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 104.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|