About 4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid
4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid (PubChem CID 59536175) has the molecular formula C19H11BrF3NO4S
and a molecular weight of 486.27 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid |
| PubChem CID | 59536175 |
| Molecular Formula | C19H11BrF3NO4S |
| Molecular Weight | 486.27 g/mol |
| Exact Mass | 484.95 |
| IUPAC Name | 4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid |
| SMILES | COc1c(F)c(F)cc(C(=O)Nc2scc(-c3ccc(Br)cc3)c2C(=O)O)c1F |
| InChI | InChI=1S/C19H11BrF3NO4S/c1-28-16-14(22)10(6-12(21)15(16)23)17(25)24-18-13(19(26)27)11(7-29-18)8-2-4-9(20)5-3-8/h2-7H,1H3,(H,24,25)(H,26,27) |
| InChIKey | GWALRCOVJHYWAZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.27 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid?
The IUPAC name of 4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid (CID 59536175) is 4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid.
What is the SMILES notation for 4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid?
The canonical SMILES for 4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid is COc1c(F)c(F)cc(C(=O)Nc2scc(-c3ccc(Br)cc3)c2C(=O)O)c1F.
What is the InChIKey of 4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid?
The InChIKey is GWALRCOVJHYWAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11BrF3NO4S/c1-28-16-14(22)10(6-12(21)15(16)23)17(25)24-18-13(19(26)27)11(7-29-18)8-2-4-9(20)5-3-8/h2-7H,1H3,(H,24,25)(H,26,27).
What are the key properties of 4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid?
4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid has a molecular weight of 486.27 g/mol, XLogP of 5.55, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-2-[(2,4,5-trifluoro-3-methoxybenzoyl)amino]thiophene-3-carboxylic acid is sourced from PubChem (CID 59536175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).