C22H34N6O — CID 59536468
5-[2-[4-(3-aminophenyl)piperazin-1-yl]ethyl]-4-(cyclohexylmethyl)-2-methyl-1,2,4-triazol-3-one (PubChem CID 59536468) has the molecular formula C22H34N6O and a molecular weight of 398.56 g/mol. Its IUPAC name is 5-[2-[4-(3-aminophenyl)piperazin-1-yl]ethyl]-4-(cyclohexylmethyl)-2-methyl-1,2,4-triazol-3-one.
| Compound Name | 5-[2-[4-(3-aminophenyl)piperazin-1-yl]ethyl]-4-(cyclohexylmethyl)-2-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 59536468 |
| Molecular Formula | C22H34N6O |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | 5-[2-[4-(3-aminophenyl)piperazin-1-yl]ethyl]-4-(cyclohexylmethyl)-2-methyl-1,2,4-triazol-3-one |
| SMILES | Cn1nc(CCN2CCN(c3cccc(N)c3)CC2)n(CC2CCCCC2)c1=O |
| InChI | InChI=1S/C22H34N6O/c1-25-22(29)28(17-18-6-3-2-4-7-18)21(24-25)10-11-26-12-14-27(15-13-26)20-9-5-8-19(23)16-20/h5,8-9,16,18H,2-4,6-7,10-15,17,23H2,1H3 |
| InChIKey | LOXKJHDNJRBOOS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|