C12H16N2O5SSi2 — CID 59537135
CID 59537135 (PubChem CID 59537135) has the molecular formula C12H16N2O5SSi2 and a molecular weight of 356.51 g/mol.
| Compound Name | CID 59537135 |
|---|---|
| PubChem CID | 59537135 |
| Molecular Formula | C12H16N2O5SSi2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | — |
| SMILES | C[Si]N[C@@H]1C(=O)N2C(C(=O)O[Si]C)=C(COC(C)=O)CS[C@H]12 |
| InChI | InChI=1S/C12H16N2O5SSi2/c1-6(15)18-4-7-5-20-11-8(13-21-2)10(16)14(11)9(7)12(17)19-22-3/h8,11,13H,4-5H2,1-3H3/t8-,11-/m1/s1 |
| InChIKey | FHPBFASFPNFDFB-LDYMZIIASA-N |
| XLogP | -0.45 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|