About 1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione
1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione (PubChem CID 59537215) has the molecular formula C19H28O4
and a molecular weight of 320.43 g/mol. Its IUPAC name is 1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione.
Molecular Properties
| Compound Name | 1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione |
| PubChem CID | 59537215 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione |
| SMILES | C=C(C)C(=O)CCCCC(=O)C1CC(C(C)=O)CC(C(C)=O)C1 |
| InChI | InChI=1S/C19H28O4/c1-12(2)18(22)7-5-6-8-19(23)17-10-15(13(3)20)9-16(11-17)14(4)21/h15-17H,1,5-11H2,2-4H3 |
| InChIKey | GVXABBSSEWJRNR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione?
The IUPAC name of 1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione (CID 59537215) is 1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione.
What is the SMILES notation for 1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione?
The canonical SMILES for 1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione is C=C(C)C(=O)CCCCC(=O)C1CC(C(C)=O)CC(C(C)=O)C1.
What is the InChIKey of 1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione?
The InChIKey is GVXABBSSEWJRNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O4/c1-12(2)18(22)7-5-6-8-19(23)17-10-15(13(3)20)9-16(11-17)14(4)21/h15-17H,1,5-11H2,2-4H3.
What are the key properties of 1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione?
1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione has a molecular weight of 320.43 g/mol, XLogP of 3.47, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-diacetylcyclohexyl)-7-methyloct-7-ene-1,6-dione is sourced from PubChem (CID 59537215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).