2-(2-propyl-1,3-dioxolan-2-yl)acetic acid

C8H14O4 — CID 59537270

IUPAC2-(2-propyl-1,3-dioxolan-2-yl)acetic acid
SMILESCCCC1(CC(=O)O)OCCO1
InChIInChI=1S/C8H14O4/c1-2-3-8(6-7(9)10)11-4-5-12-8/h2-6H2,1H3,(H,9,10)
InChIKeyMNOZBVQGZXOGRT-UHFFFAOYSA-N
MW174.20 g/mol
LogP1.00
Rot. Bonds4

About 2-(2-propyl-1,3-dioxolan-2-yl)acetic acid

2-(2-propyl-1,3-dioxolan-2-yl)acetic acid (PubChem CID 59537270) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-(2-propyl-1,3-dioxolan-2-yl)acetic acid.

Molecular Properties

Compound Name2-(2-propyl-1,3-dioxolan-2-yl)acetic acid
PubChem CID59537270
Molecular FormulaC8H14O4
Molecular Weight174.20 g/mol
Exact Mass174.09
IUPAC Name2-(2-propyl-1,3-dioxolan-2-yl)acetic acid
SMILESCCCC1(CC(=O)O)OCCO1
InChIInChI=1S/C8H14O4/c1-2-3-8(6-7(9)10)11-4-5-12-8/h2-6H2,1H3,(H,9,10)
InChIKeyMNOZBVQGZXOGRT-UHFFFAOYSA-N
XLogP1.00
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.20
LogP ≤ 51.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2-propyl-1,3-dioxolan-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-propyl-1,3-dioxolan-2-yl)acetic acid?
The IUPAC name of 2-(2-propyl-1,3-dioxolan-2-yl)acetic acid (CID 59537270) is 2-(2-propyl-1,3-dioxolan-2-yl)acetic acid.
What is the SMILES notation for 2-(2-propyl-1,3-dioxolan-2-yl)acetic acid?
The canonical SMILES for 2-(2-propyl-1,3-dioxolan-2-yl)acetic acid is CCCC1(CC(=O)O)OCCO1.
What is the InChIKey of 2-(2-propyl-1,3-dioxolan-2-yl)acetic acid?
The InChIKey is MNOZBVQGZXOGRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-2-3-8(6-7(9)10)11-4-5-12-8/h2-6H2,1H3,(H,9,10).
What are the key properties of 2-(2-propyl-1,3-dioxolan-2-yl)acetic acid?
2-(2-propyl-1,3-dioxolan-2-yl)acetic acid has a molecular weight of 174.20 g/mol, XLogP of 1.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-propyl-1,3-dioxolan-2-yl)acetic acid is sourced from PubChem (CID 59537270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).