C24H33N3O2S — CID 59537582
N-(2-amino-1,2-diphenylethyl)-1-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl)methanesulfonamide (PubChem CID 59537582) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is N-(2-amino-1,2-diphenylethyl)-1-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl)methanesulfonamide.
| Compound Name | N-(2-amino-1,2-diphenylethyl)-1-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl)methanesulfonamide |
|---|---|
| PubChem CID | 59537582 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-(2-amino-1,2-diphenylethyl)-1-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl)methanesulfonamide |
| SMILES | NC(c1ccccc1)C(NS(=O)(=O)CC1CCCN2CCCCC12)c1ccccc1 |
| InChI | InChI=1S/C24H33N3O2S/c25-23(19-10-3-1-4-11-19)24(20-12-5-2-6-13-20)26-30(28,29)18-21-14-9-17-27-16-8-7-15-22(21)27/h1-6,10-13,21-24,26H,7-9,14-18,25H2 |
| InChIKey | HTMDWPURYCEKMV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |