About [3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate
[3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate (PubChem CID 59538243) has the molecular formula C22H31NO4S
and a molecular weight of 405.56 g/mol. Its IUPAC name is [3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate.
Molecular Properties
| Compound Name | [3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate |
| PubChem CID | 59538243 |
| Molecular Formula | C22H31NO4S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | [3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate |
| SMILES | CCc1cc(C)cc(CC)c1C1=C(OS(C)(=O)=O)C2(CCC(C)CC2)NC1=O |
| InChI | InChI=1S/C22H31NO4S/c1-6-16-12-15(4)13-17(7-2)18(16)19-20(27-28(5,25)26)22(23-21(19)24)10-8-14(3)9-11-22/h12-14H,6-11H2,1-5H3,(H,23,24) |
| InChIKey | DKGIMOJXJPQNAW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate?
The IUPAC name of [3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate (CID 59538243) is [3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate.
What is the SMILES notation for [3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate?
The canonical SMILES for [3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate is CCc1cc(C)cc(CC)c1C1=C(OS(C)(=O)=O)C2(CCC(C)CC2)NC1=O.
What is the InChIKey of [3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate?
The InChIKey is DKGIMOJXJPQNAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO4S/c1-6-16-12-15(4)13-17(7-2)18(16)19-20(27-28(5,25)26)22(23-21(19)24)10-8-14(3)9-11-22/h12-14H,6-11H2,1-5H3,(H,23,24).
What are the key properties of [3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate?
[3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate has a molecular weight of 405.56 g/mol, XLogP of 3.89, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,6-diethyl-4-methylphenyl)-8-methyl-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] methanesulfonate is sourced from PubChem (CID 59538243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).