C26H28N2O4S2 — CID 59538347
2-[5-[1-(10-ethylphenothiazin-3-yl)heptylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 59538347) has the molecular formula C26H28N2O4S2 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-[5-[1-(10-ethylphenothiazin-3-yl)heptylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[5-[1-(10-ethylphenothiazin-3-yl)heptylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 59538347 |
| Molecular Formula | C26H28N2O4S2 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 2-[5-[1-(10-ethylphenothiazin-3-yl)heptylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCCCCCC(=C1SC(=O)N(CC(=O)O)C1=O)c1ccc2c(c1)Sc1ccccc1N2CC |
| InChI | InChI=1S/C26H28N2O4S2/c1-3-5-6-7-10-18(24-25(31)28(16-23(29)30)26(32)34-24)17-13-14-20-22(15-17)33-21-12-9-8-11-19(21)27(20)4-2/h8-9,11-15H,3-7,10,16H2,1-2H3,(H,29,30) |
| InChIKey | ZHEBBYGNMRKXPV-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|