C38H16F6N2O6 — CID 59538415
7,18-bis[4-(trifluoromethoxy)phenyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone (PubChem CID 59538415) has the molecular formula C38H16F6N2O6 and a molecular weight of 710.54 g/mol. Its IUPAC name is 7,18-bis[4-(trifluoromethoxy)phenyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone.
| Compound Name | 7,18-bis[4-(trifluoromethoxy)phenyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 59538415 |
| Molecular Formula | C38H16F6N2O6 |
| Molecular Weight | 710.54 g/mol |
| Exact Mass | 710.09 |
| IUPAC Name | 7,18-bis[4-(trifluoromethoxy)phenyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| SMILES | O=C1c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C(=O)N1c1ccc(OC(F)(F)F)cc1)c64)C(=O)N(c1ccc(OC(F)(F)F)cc1)C5=O |
| InChI | InChI=1S/C38H16F6N2O6/c39-37(40,41)51-19-5-1-17(2-6-19)45-33(47)25-13-9-21-23-11-15-27-32-28(16-12-24(30(23)32)22-10-14-26(34(45)48)31(25)29(21)22)36(50)46(35(27)49)18-3-7-20(8-4-18)52-38(42,43)44/h1-16H |
| InChIKey | LRMHBPQDNDAYET-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.54 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|