C26H15IrN3O-2 — CID 59538551
CID 59538551 (PubChem CID 59538551) has the molecular formula C26H15IrN3O-2 and a molecular weight of 577.64 g/mol.
| Compound Name | CID 59538551 |
|---|---|
| PubChem CID | 59538551 |
| Molecular Formula | C26H15IrN3O-2 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | — |
| SMILES | [Ir].[c-]1cccc2c1N1[CH-]N(c3cccc4c3oc3ccccc34)N=C1c1ccccc1-2 |
| InChI | InChI=1S/C26H15N3O.Ir/c1-2-11-21-17(8-1)18-9-3-5-13-22(18)28-16-29(27-26(21)28)23-14-7-12-20-19-10-4-6-15-24(19)30-25(20)23;/h1-12,14-16H;/q-2; |
| InChIKey | WHSOQPJETQHQJQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|