About 8-methyl-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one
8-methyl-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one (PubChem CID 59538715) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 8-methyl-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one.
Analyze 8-methyl-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one?
The IUPAC name of 8-methyl-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one (CID 59538715) is 8-methyl-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one.
What is the SMILES notation for 8-methyl-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one?
The canonical SMILES for 8-methyl-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one is CC1CNCc2ccc(=O)[nH]c21.
What is the InChIKey of 8-methyl-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one?
The InChIKey is JXMXXDSAQIOTFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-6-4-10-5-7-2-3-8(12)11-9(6)7/h2-3,6,10H,4-5H2,1H3,(H,11,12).
What are the key properties of 8-methyl-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one?
8-methyl-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one has a molecular weight of 164.21 g/mol, XLogP of 0.58, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one is sourced from PubChem (CID 59538715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).