C14H19NO2 — CID 59538777
(2E,4E)-5-[2-[[(2E,4E)-hepta-2,4-dien-6-yn-2-yl]amino]ethoxy]penta-2,4-dien-2-ol (PubChem CID 59538777) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (2E,4E)-5-[2-[[(2E,4E)-hepta-2,4-dien-6-yn-2-yl]amino]ethoxy]penta-2,4-dien-2-ol.
| Compound Name | (2E,4E)-5-[2-[[(2E,4E)-hepta-2,4-dien-6-yn-2-yl]amino]ethoxy]penta-2,4-dien-2-ol |
|---|---|
| PubChem CID | 59538777 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (2E,4E)-5-[2-[[(2E,4E)-hepta-2,4-dien-6-yn-2-yl]amino]ethoxy]penta-2,4-dien-2-ol |
| SMILES | C#C/C=C/C=C(\C)NCCO/C=C/C=C(\C)O |
| InChI | InChI=1S/C14H19NO2/c1-4-5-6-8-13(2)15-10-12-17-11-7-9-14(3)16/h1,5-9,11,15-16H,10,12H2,2-3H3/b6-5+,11-7+,13-8+,14-9+ |
| InChIKey | JFXIEKXXCSKQEP-DYCKLRFTSA-N |
| XLogP | 2.66 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|