About [4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium
[4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium (PubChem CID 59538998) has the molecular formula C11H12N3O4SY-
and a molecular weight of 371.21 g/mol. Its IUPAC name is [4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium.
Molecular Properties
| Compound Name | [4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium |
| PubChem CID | 59538998 |
| Molecular Formula | C11H12N3O4SY- |
| Molecular Weight | 371.21 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | [4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium |
| SMILES | [CH2-]NC(=O)c1cccn2nc(COS(C)(=O)=O)cc12.[Y] |
| InChI | InChI=1S/C11H12N3O4S.Y/c1-12-11(15)9-4-3-5-14-10(9)6-8(13-14)7-18-19(2,16)17;/h3-6H,1,7H2,2H3,(H,12,15);/q-1; |
| InChIKey | NMUIPTOPOXQQED-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium?
The IUPAC name of [4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium (CID 59538998) is [4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium.
What is the SMILES notation for [4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium?
The canonical SMILES for [4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium is [CH2-]NC(=O)c1cccn2nc(COS(C)(=O)=O)cc12.[Y].
What is the InChIKey of [4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium?
The InChIKey is NMUIPTOPOXQQED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N3O4S.Y/c1-12-11(15)9-4-3-5-14-10(9)6-8(13-14)7-18-19(2,16)17;/h3-6H,1,7H2,2H3,(H,12,15);/q-1;.
What are the key properties of [4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium?
[4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium has a molecular weight of 371.21 g/mol, XLogP of 0.33, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(methanidylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl methanesulfonate;yttrium is sourced from PubChem (CID 59538998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).