C21H19Cl2N3O3S2 — CID 59539351
5-N-[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-N-ethyl-2-N-methylthiophene-2,5-dicarboxamide (PubChem CID 59539351) has the molecular formula C21H19Cl2N3O3S2 and a molecular weight of 496.44 g/mol. Its IUPAC name is 5-N-[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-N-ethyl-2-N-methylthiophene-2,5-dicarboxamide.
| Compound Name | 5-N-[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-N-ethyl-2-N-methylthiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 59539351 |
| Molecular Formula | C21H19Cl2N3O3S2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | 5-N-[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-N-ethyl-2-N-methylthiophene-2,5-dicarboxamide |
| SMILES | CCN(C)C(=O)c1ccc(C(=O)N/N=C(\C)c2csc(-c3ccc(Cl)c(Cl)c3)c2O)s1 |
| InChI | InChI=1S/C21H19Cl2N3O3S2/c1-4-26(3)21(29)17-8-7-16(31-17)20(28)25-24-11(2)13-10-30-19(18(13)27)12-5-6-14(22)15(23)9-12/h5-10,27H,4H2,1-3H3,(H,25,28)/b24-11+ |
| InChIKey | CGPWFMCYNFURQS-BHGWPJFGSA-N |
| XLogP | 5.73 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|