About 5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine
5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine (PubChem CID 59539524) has the molecular formula C11H15F3N2
and a molecular weight of 232.25 g/mol. Its IUPAC name is 5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine |
| PubChem CID | 59539524 |
| Molecular Formula | C11H15F3N2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine |
| SMILES | C[C@H](c1cnc(C(F)(F)F)nc1)C(C)(C)C |
| InChI | InChI=1S/C11H15F3N2/c1-7(10(2,3)4)8-5-15-9(16-6-8)11(12,13)14/h5-7H,1-4H3/t7-/m1/s1 |
| InChIKey | BJOQOMFOHRPBLR-SSDOTTSWSA-N |
| XLogP | 3.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine?
The IUPAC name of 5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine (CID 59539524) is 5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine?
The canonical SMILES for 5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine is C[C@H](c1cnc(C(F)(F)F)nc1)C(C)(C)C.
What is the InChIKey of 5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine?
The InChIKey is BJOQOMFOHRPBLR-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H15F3N2/c1-7(10(2,3)4)8-5-15-9(16-6-8)11(12,13)14/h5-7H,1-4H3/t7-/m1/s1.
What are the key properties of 5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine?
5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine has a molecular weight of 232.25 g/mol, XLogP of 3.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S)-3,3-dimethylbutan-2-yl]-2-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 59539524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).