About 7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine
7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (PubChem CID 59539567) has the molecular formula C11H16F3N3
and a molecular weight of 247.26 g/mol. Its IUPAC name is 7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| PubChem CID | 59539567 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| SMILES | CC(C)(C)N1CCn2cc(C(F)(F)F)nc2C1 |
| InChI | InChI=1S/C11H16F3N3/c1-10(2,3)17-5-4-16-6-8(11(12,13)14)15-9(16)7-17/h6H,4-5,7H2,1-3H3 |
| InChIKey | TZHPEWYFYDKTEW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The IUPAC name of 7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (CID 59539567) is 7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
What is the SMILES notation for 7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The canonical SMILES for 7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine is CC(C)(C)N1CCn2cc(C(F)(F)F)nc2C1.
What is the InChIKey of 7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The InChIKey is TZHPEWYFYDKTEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N3/c1-10(2,3)17-5-4-16-6-8(11(12,13)14)15-9(16)7-17/h6H,4-5,7H2,1-3H3.
What are the key properties of 7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine has a molecular weight of 247.26 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine is sourced from PubChem (CID 59539567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).