About 2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one
2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 59539834) has the molecular formula C9H12O5
and a molecular weight of 200.19 g/mol. Its IUPAC name is 2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one.
Molecular Properties
| Compound Name | 2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one |
| PubChem CID | 59539834 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | COCOC1C2CC3C(=O)OC1C3O2 |
| InChI | InChI=1S/C9H12O5/c1-11-3-12-7-5-2-4-6(13-5)8(7)14-9(4)10/h4-8H,2-3H2,1H3 |
| InChIKey | XTIZQKBJZRLINH-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
The IUPAC name of 2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one (CID 59539834) is 2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one.
What is the SMILES notation for 2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
The canonical SMILES for 2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one is COCOC1C2CC3C(=O)OC1C3O2.
What is the InChIKey of 2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
The InChIKey is XTIZQKBJZRLINH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O5/c1-11-3-12-7-5-2-4-6(13-5)8(7)14-9(4)10/h4-8H,2-3H2,1H3.
What are the key properties of 2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one?
2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one has a molecular weight of 200.19 g/mol, XLogP of -0.31, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethoxy)-4,8-dioxatricyclo[4.2.1.03,7]nonan-5-one is sourced from PubChem (CID 59539834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).