C36H58N2O3S — CID 59539913
N,N-didecyl-4-[2-[1-(3-oxidoperoxysulfanylpropyl)pyridin-1-ium-4-yl]ethenyl]aniline (PubChem CID 59539913) has the molecular formula C36H58N2O3S and a molecular weight of 598.94 g/mol. Its IUPAC name is N,N-didecyl-4-[2-[1-(3-oxidoperoxysulfanylpropyl)pyridin-1-ium-4-yl]ethenyl]aniline.
| Compound Name | N,N-didecyl-4-[2-[1-(3-oxidoperoxysulfanylpropyl)pyridin-1-ium-4-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 59539913 |
| Molecular Formula | C36H58N2O3S |
| Molecular Weight | 598.94 g/mol |
| Exact Mass | 598.42 |
| IUPAC Name | N,N-didecyl-4-[2-[1-(3-oxidoperoxysulfanylpropyl)pyridin-1-ium-4-yl]ethenyl]aniline |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)c1ccc(C=Cc2cc[n+](CCCSOO[O-])cc2)cc1 |
| InChI | InChI=1S/C36H58N2O3S/c1-3-5-7-9-11-13-15-17-29-38(30-18-16-14-12-10-8-6-4-2)36-24-22-34(23-25-36)20-21-35-26-31-37(32-27-35)28-19-33-42-41-40-39/h20-27,31-32H,3-19,28-30,33H2,1-2H3 |
| InChIKey | AQMCIYMGUCPILO-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.94 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|