About 7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one
7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one (PubChem CID 59539927) has the molecular formula C25H30O5S
and a molecular weight of 442.58 g/mol. Its IUPAC name is 7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one.
Molecular Properties
| Compound Name | 7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one |
| PubChem CID | 59539927 |
| Molecular Formula | C25H30O5S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one |
| SMILES | CCCCCCCCCCc1ccc2c(=O)c(O)c(-c3cc(O)c(O)c(O)c3)sc2c1 |
| InChI | InChI=1S/C25H30O5S/c1-2-3-4-5-6-7-8-9-10-16-11-12-18-21(13-16)31-25(24(30)22(18)28)17-14-19(26)23(29)20(27)15-17/h11-15,26-27,29-30H,2-10H2,1H3 |
| InChIKey | YWZLJFRMGZHZHA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one?
The IUPAC name of 7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one (CID 59539927) is 7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one.
What is the SMILES notation for 7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one?
The canonical SMILES for 7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one is CCCCCCCCCCc1ccc2c(=O)c(O)c(-c3cc(O)c(O)c(O)c3)sc2c1.
What is the InChIKey of 7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one?
The InChIKey is YWZLJFRMGZHZHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30O5S/c1-2-3-4-5-6-7-8-9-10-16-11-12-18-21(13-16)31-25(24(30)22(18)28)17-14-19(26)23(29)20(27)15-17/h11-15,26-27,29-30H,2-10H2,1H3.
What are the key properties of 7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one?
7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one has a molecular weight of 442.58 g/mol, XLogP of 6.43, 10 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)thiochromen-4-one is sourced from PubChem (CID 59539927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).