C25H26O6 — CID 59539942
3-hydroxy-7-[(3E)-8-methylnona-3,7-dienyl]-2-(3,4,5-trihydroxyphenyl)chromen-4-one (PubChem CID 59539942) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is 3-hydroxy-7-[(3E)-8-methylnona-3,7-dienyl]-2-(3,4,5-trihydroxyphenyl)chromen-4-one.
| Compound Name | 3-hydroxy-7-[(3E)-8-methylnona-3,7-dienyl]-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 59539942 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 3-hydroxy-7-[(3E)-8-methylnona-3,7-dienyl]-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| SMILES | CC(C)=CCC/C=C/CCc1ccc2c(=O)c(O)c(-c3cc(O)c(O)c(O)c3)oc2c1 |
| InChI | InChI=1S/C25H26O6/c1-15(2)8-6-4-3-5-7-9-16-10-11-18-21(12-16)31-25(24(30)22(18)28)17-13-19(26)23(29)20(27)14-17/h3,5,8,10-14,26-27,29-30H,4,6-7,9H2,1-2H3/b5-3+ |
| InChIKey | HNEVYKAAVCGTOR-HWKANZROSA-N |
| XLogP | 5.52 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|