About 1,4-dimethyl-2,5-di(propan-2-yl)imidazole
1,4-dimethyl-2,5-di(propan-2-yl)imidazole (PubChem CID 59540235) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 1,4-dimethyl-2,5-di(propan-2-yl)imidazole.
Molecular Properties
| Compound Name | 1,4-dimethyl-2,5-di(propan-2-yl)imidazole |
| PubChem CID | 59540235 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1,4-dimethyl-2,5-di(propan-2-yl)imidazole |
| SMILES | Cc1nc(C(C)C)n(C)c1C(C)C |
| InChI | InChI=1S/C11H20N2/c1-7(2)10-9(5)12-11(8(3)4)13(10)6/h7-8H,1-6H3 |
| InChIKey | RDXLTLIERIFLLT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dimethyl-2,5-di(propan-2-yl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2,5-di(propan-2-yl)imidazole?
The IUPAC name of 1,4-dimethyl-2,5-di(propan-2-yl)imidazole (CID 59540235) is 1,4-dimethyl-2,5-di(propan-2-yl)imidazole.
What is the SMILES notation for 1,4-dimethyl-2,5-di(propan-2-yl)imidazole?
The canonical SMILES for 1,4-dimethyl-2,5-di(propan-2-yl)imidazole is Cc1nc(C(C)C)n(C)c1C(C)C.
What is the InChIKey of 1,4-dimethyl-2,5-di(propan-2-yl)imidazole?
The InChIKey is RDXLTLIERIFLLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-7(2)10-9(5)12-11(8(3)4)13(10)6/h7-8H,1-6H3.
What are the key properties of 1,4-dimethyl-2,5-di(propan-2-yl)imidazole?
1,4-dimethyl-2,5-di(propan-2-yl)imidazole has a molecular weight of 180.29 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2,5-di(propan-2-yl)imidazole is sourced from PubChem (CID 59540235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).