About oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate
oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate (PubChem CID 59540410) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate |
| PubChem CID | 59540410 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate |
| SMILES | CC(C)C1CCCN1C(=O)OC1CCOC1 |
| InChI | InChI=1S/C12H21NO3/c1-9(2)11-4-3-6-13(11)12(14)16-10-5-7-15-8-10/h9-11H,3-8H2,1-2H3 |
| InChIKey | FZEKWURPBMTGFM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate?
The IUPAC name of oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate (CID 59540410) is oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate.
What is the SMILES notation for oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate?
The canonical SMILES for oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate is CC(C)C1CCCN1C(=O)OC1CCOC1.
What is the InChIKey of oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate?
The InChIKey is FZEKWURPBMTGFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-9(2)11-4-3-6-13(11)12(14)16-10-5-7-15-8-10/h9-11H,3-8H2,1-2H3.
What are the key properties of oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate?
oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate has a molecular weight of 227.30 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate is sourced from PubChem (CID 59540410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).