oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate

C12H21NO3 — CID 59540410

IUPACoxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate
SMILESCC(C)C1CCCN1C(=O)OC1CCOC1
InChIInChI=1S/C12H21NO3/c1-9(2)11-4-3-6-13(11)12(14)16-10-5-7-15-8-10/h9-11H,3-8H2,1-2H3
InChIKeyFZEKWURPBMTGFM-UHFFFAOYSA-N
MW227.30 g/mol
LogP2.03
Rot. Bonds2

About oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate

oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate (PubChem CID 59540410) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate.

Molecular Properties

Compound Nameoxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate
PubChem CID59540410
Molecular FormulaC12H21NO3
Molecular Weight227.30 g/mol
Exact Mass227.15
IUPAC Nameoxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate
SMILESCC(C)C1CCCN1C(=O)OC1CCOC1
InChIInChI=1S/C12H21NO3/c1-9(2)11-4-3-6-13(11)12(14)16-10-5-7-15-8-10/h9-11H,3-8H2,1-2H3
InChIKeyFZEKWURPBMTGFM-UHFFFAOYSA-N
XLogP2.03
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.30
LogP ≤ 52.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate?
The IUPAC name of oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate (CID 59540410) is oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate.
What is the SMILES notation for oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate?
The canonical SMILES for oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate is CC(C)C1CCCN1C(=O)OC1CCOC1.
What is the InChIKey of oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate?
The InChIKey is FZEKWURPBMTGFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-9(2)11-4-3-6-13(11)12(14)16-10-5-7-15-8-10/h9-11H,3-8H2,1-2H3.
What are the key properties of oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate?
oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate has a molecular weight of 227.30 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl 2-propan-2-ylpyrrolidine-1-carboxylate is sourced from PubChem (CID 59540410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).