C24H30N4O6S — CID 59540572
1-[2-[3-(1,3-dihydroxypropan-2-yloxy)-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropan-1-one (PubChem CID 59540572) has the molecular formula C24H30N4O6S and a molecular weight of 502.59 g/mol. Its IUPAC name is 1-[2-[3-(1,3-dihydroxypropan-2-yloxy)-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[2-[3-(1,3-dihydroxypropan-2-yloxy)-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 59540572 |
| Molecular Formula | C24H30N4O6S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 1-[2-[3-(1,3-dihydroxypropan-2-yloxy)-5-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1c[nH]c2ncc(-c3cc(OC(CO)CO)cc(N4CCS(=O)(=O)CC4)c3)nc12 |
| InChI | InChI=1S/C24H30N4O6S/c1-24(2,3)22(31)19-11-25-23-21(19)27-20(12-26-23)15-8-16(28-4-6-35(32,33)7-5-28)10-17(9-15)34-18(13-29)14-30/h8-12,18,29-30H,4-7,13-14H2,1-3H3,(H,25,26) |
| InChIKey | VHVYCANTDNQDKX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |