C23H22F3N7O — CID 59540610
2,2-dimethyl-1-[2-[3-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one (PubChem CID 59540610) has the molecular formula C23H22F3N7O and a molecular weight of 469.47 g/mol. Its IUPAC name is 2,2-dimethyl-1-[2-[3-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[2-[3-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one |
|---|---|
| PubChem CID | 59540610 |
| Molecular Formula | C23H22F3N7O |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 2,2-dimethyl-1-[2-[3-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one |
| SMILES | CC(C)(C)C(=O)c1c[nH]c2ncc(-c3cccc(N4CCn5c(nnc5C(F)(F)F)C4)c3)nc12 |
| InChI | InChI=1S/C23H22F3N7O/c1-22(2,3)19(34)15-10-27-20-18(15)29-16(11-28-20)13-5-4-6-14(9-13)32-7-8-33-17(12-32)30-31-21(33)23(24,25)26/h4-6,9-11H,7-8,12H2,1-3H3,(H,27,28) |
| InChIKey | HRQFONBELYKEPB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |