C27H30F9N3O5SSi — CID 59540644
[3-[7-(2,2-dimethylpropanoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 59540644) has the molecular formula C27H30F9N3O5SSi and a molecular weight of 707.69 g/mol. Its IUPAC name is [3-[7-(2,2-dimethylpropanoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [3-[7-(2,2-dimethylpropanoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 59540644 |
| Molecular Formula | C27H30F9N3O5SSi |
| Molecular Weight | 707.69 g/mol |
| Exact Mass | 707.15 |
| IUPAC Name | [3-[7-(2,2-dimethylpropanoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CC(C)(C)C(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3cccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C27H30F9N3O5SSi/c1-23(2,3)21(40)18-14-39(15-43-10-11-46(4,5)6)22-20(18)38-19(13-37-22)16-8-7-9-17(12-16)44-45(41,42)27(35,36)25(30,31)24(28,29)26(32,33)34/h7-9,12-14H,10-11,15H2,1-6H3 |
| InChIKey | IGOFGONNJYTNDV-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.69 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|