C27H39N5O2Si — CID 59540668
2,2-dimethyl-1-[2-(3-piperazin-1-ylphenyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one (PubChem CID 59540668) has the molecular formula C27H39N5O2Si and a molecular weight of 493.73 g/mol. Its IUPAC name is 2,2-dimethyl-1-[2-(3-piperazin-1-ylphenyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[2-(3-piperazin-1-ylphenyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one |
|---|---|
| PubChem CID | 59540668 |
| Molecular Formula | C27H39N5O2Si |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | 2,2-dimethyl-1-[2-(3-piperazin-1-ylphenyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one |
| SMILES | CC(C)(C)C(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3cccc(N4CCNCC4)c3)nc12 |
| InChI | InChI=1S/C27H39N5O2Si/c1-27(2,3)25(33)22-18-32(19-34-14-15-35(4,5)6)26-24(22)30-23(17-29-26)20-8-7-9-21(16-20)31-12-10-28-11-13-31/h7-9,16-18,28H,10-15,19H2,1-6H3 |
| InChIKey | HTHPDWWXXDZTAH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|