About [(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol
[(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol (PubChem CID 59540724) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is [(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol.
Molecular Properties
| Compound Name | [(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol |
| PubChem CID | 59540724 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | [(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol |
| SMILES | CN1C[C@@H]2C(CO)[C@@H]2C1 |
| InChI | InChI=1S/C7H13NO/c1-8-2-5-6(3-8)7(5)4-9/h5-7,9H,2-4H2,1H3/t5-,6+,7? |
| InChIKey | NBDARIFQUROSPQ-MEKDEQNOSA-N |
| XLogP | -0.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol?
The IUPAC name of [(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol (CID 59540724) is [(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol.
What is the SMILES notation for [(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol?
The canonical SMILES for [(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol is CN1C[C@@H]2C(CO)[C@@H]2C1.
What is the InChIKey of [(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol?
The InChIKey is NBDARIFQUROSPQ-MEKDEQNOSA-N. The full InChI is InChI=1S/C7H13NO/c1-8-2-5-6(3-8)7(5)4-9/h5-7,9H,2-4H2,1H3/t5-,6+,7?.
What are the key properties of [(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol?
[(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol has a molecular weight of 127.19 g/mol, XLogP of -0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]methanol is sourced from PubChem (CID 59540724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).