About 3,3-ditert-butyl-2H-1,2-benzoxazole
3,3-ditert-butyl-2H-1,2-benzoxazole (PubChem CID 59541087) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is 3,3-ditert-butyl-2H-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3,3-ditert-butyl-2H-1,2-benzoxazole |
| PubChem CID | 59541087 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 3,3-ditert-butyl-2H-1,2-benzoxazole |
| SMILES | CC(C)(C)C1(C(C)(C)C)NOc2ccccc21 |
| InChI | InChI=1S/C15H23NO/c1-13(2,3)15(14(4,5)6)11-9-7-8-10-12(11)17-16-15/h7-10,16H,1-6H3 |
| InChIKey | HDMNIJDJSJOVTO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-ditert-butyl-2H-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-ditert-butyl-2H-1,2-benzoxazole?
The IUPAC name of 3,3-ditert-butyl-2H-1,2-benzoxazole (CID 59541087) is 3,3-ditert-butyl-2H-1,2-benzoxazole.
What is the SMILES notation for 3,3-ditert-butyl-2H-1,2-benzoxazole?
The canonical SMILES for 3,3-ditert-butyl-2H-1,2-benzoxazole is CC(C)(C)C1(C(C)(C)C)NOc2ccccc21.
What is the InChIKey of 3,3-ditert-butyl-2H-1,2-benzoxazole?
The InChIKey is HDMNIJDJSJOVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-13(2,3)15(14(4,5)6)11-9-7-8-10-12(11)17-16-15/h7-10,16H,1-6H3.
What are the key properties of 3,3-ditert-butyl-2H-1,2-benzoxazole?
3,3-ditert-butyl-2H-1,2-benzoxazole has a molecular weight of 233.35 g/mol, XLogP of 3.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-ditert-butyl-2H-1,2-benzoxazole is sourced from PubChem (CID 59541087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).