About 1-azaspiro[4.5]dec-3-ene-2,8-dione
1-azaspiro[4.5]dec-3-ene-2,8-dione (PubChem CID 59541097) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 1-azaspiro[4.5]dec-3-ene-2,8-dione.
Molecular Properties
| Compound Name | 1-azaspiro[4.5]dec-3-ene-2,8-dione |
| PubChem CID | 59541097 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 1-azaspiro[4.5]dec-3-ene-2,8-dione |
| SMILES | O=C1CCC2(C=CC(=O)N2)CC1 |
| InChI | InChI=1S/C9H11NO2/c11-7-1-4-9(5-2-7)6-3-8(12)10-9/h3,6H,1-2,4-5H2,(H,10,12) |
| InChIKey | SMEQORUSBLOKHX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-azaspiro[4.5]dec-3-ene-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azaspiro[4.5]dec-3-ene-2,8-dione?
The IUPAC name of 1-azaspiro[4.5]dec-3-ene-2,8-dione (CID 59541097) is 1-azaspiro[4.5]dec-3-ene-2,8-dione.
What is the SMILES notation for 1-azaspiro[4.5]dec-3-ene-2,8-dione?
The canonical SMILES for 1-azaspiro[4.5]dec-3-ene-2,8-dione is O=C1CCC2(C=CC(=O)N2)CC1.
What is the InChIKey of 1-azaspiro[4.5]dec-3-ene-2,8-dione?
The InChIKey is SMEQORUSBLOKHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c11-7-1-4-9(5-2-7)6-3-8(12)10-9/h3,6H,1-2,4-5H2,(H,10,12).
What are the key properties of 1-azaspiro[4.5]dec-3-ene-2,8-dione?
1-azaspiro[4.5]dec-3-ene-2,8-dione has a molecular weight of 165.19 g/mol, XLogP of 0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azaspiro[4.5]dec-3-ene-2,8-dione is sourced from PubChem (CID 59541097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).