C14H19N — CID 59542270
(4aS,9bS)-4a,7-dimethyl-1,2,3,4,5,9b-hexahydroindeno[1,2-b]pyridine (PubChem CID 59542270) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (4aS,9bS)-4a,7-dimethyl-1,2,3,4,5,9b-hexahydroindeno[1,2-b]pyridine.
| Compound Name | (4aS,9bS)-4a,7-dimethyl-1,2,3,4,5,9b-hexahydroindeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 59542270 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (4aS,9bS)-4a,7-dimethyl-1,2,3,4,5,9b-hexahydroindeno[1,2-b]pyridine |
| SMILES | Cc1ccc2c(c1)C[C@]1(C)CCCN[C@H]21 |
| InChI | InChI=1S/C14H19N/c1-10-4-5-12-11(8-10)9-14(2)6-3-7-15-13(12)14/h4-5,8,13,15H,3,6-7,9H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | ZGGKCJKYFGQIBZ-KGLIPLIRSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |