About N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide
N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide (PubChem CID 59542700) has the molecular formula C20H27N3OS
and a molecular weight of 357.52 g/mol. Its IUPAC name is N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide.
Molecular Properties
| Compound Name | N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide |
| PubChem CID | 59542700 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide |
| SMILES | CCN(c1nc(CN(C(=O)C(C)(C)C)c2ccccc2)cs1)C1CC1 |
| InChI | InChI=1S/C20H27N3OS/c1-5-22(17-11-12-17)19-21-15(14-25-19)13-23(18(24)20(2,3)4)16-9-7-6-8-10-16/h6-10,14,17H,5,11-13H2,1-4H3 |
| InChIKey | ISESHHAWJYXAHG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide?
The IUPAC name of N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide (CID 59542700) is N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide.
What is the SMILES notation for N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide?
The canonical SMILES for N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide is CCN(c1nc(CN(C(=O)C(C)(C)C)c2ccccc2)cs1)C1CC1.
What is the InChIKey of N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide?
The InChIKey is ISESHHAWJYXAHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3OS/c1-5-22(17-11-12-17)19-21-15(14-25-19)13-23(18(24)20(2,3)4)16-9-7-6-8-10-16/h6-10,14,17H,5,11-13H2,1-4H3.
What are the key properties of N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide?
N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide has a molecular weight of 357.52 g/mol, XLogP of 4.71, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-[cyclopropyl(ethyl)amino]-1,3-thiazol-4-yl]methyl]-2,2-dimethyl-N-phenylpropanamide is sourced from PubChem (CID 59542700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).