About cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate
cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate (PubChem CID 59542979) has the molecular formula C20H24ClN3O2S
and a molecular weight of 405.95 g/mol. Its IUPAC name is cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate.
Molecular Properties
| Compound Name | cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate |
| PubChem CID | 59542979 |
| Molecular Formula | C20H24ClN3O2S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate |
| SMILES | Nc1cc(Cl)cc2cc(C3=N[C@H](CCC(=O)OC4CCCCC4)CS3)[nH]c12 |
| InChI | InChI=1S/C20H24ClN3O2S/c21-13-8-12-9-17(24-19(12)16(22)10-13)20-23-14(11-27-20)6-7-18(25)26-15-4-2-1-3-5-15/h8-10,14-15,24H,1-7,11,22H2/t14-/m1/s1 |
| InChIKey | UUIHRIIYISQCLV-CQSZACIVSA-N |
| XLogP | 4.92 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate?
The IUPAC name of cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate (CID 59542979) is cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate.
What is the SMILES notation for cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate?
The canonical SMILES for cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate is Nc1cc(Cl)cc2cc(C3=N[C@H](CCC(=O)OC4CCCCC4)CS3)[nH]c12.
What is the InChIKey of cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate?
The InChIKey is UUIHRIIYISQCLV-CQSZACIVSA-N. The full InChI is InChI=1S/C20H24ClN3O2S/c21-13-8-12-9-17(24-19(12)16(22)10-13)20-23-14(11-27-20)6-7-18(25)26-15-4-2-1-3-5-15/h8-10,14-15,24H,1-7,11,22H2/t14-/m1/s1.
What are the key properties of cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate?
cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate has a molecular weight of 405.95 g/mol, XLogP of 4.92, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 3-[(4R)-2-(7-amino-5-chloro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]propanoate is sourced from PubChem (CID 59542979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).