C17H20FN3O2S — CID 59542991
[(4R)-2-(7-amino-5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]methyl 2,2-dimethylpropanoate (PubChem CID 59542991) has the molecular formula C17H20FN3O2S and a molecular weight of 349.43 g/mol. Its IUPAC name is [(4R)-2-(7-amino-5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(4R)-2-(7-amino-5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59542991 |
| Molecular Formula | C17H20FN3O2S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [(4R)-2-(7-amino-5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@@H]1CSC(c2cc3cc(F)cc(N)c3[nH]2)=N1 |
| InChI | InChI=1S/C17H20FN3O2S/c1-17(2,3)16(22)23-7-11-8-24-15(20-11)13-5-9-4-10(18)6-12(19)14(9)21-13/h4-6,11,21H,7-8,19H2,1-3H3/t11-/m1/s1 |
| InChIKey | UBBZVPKHPVPVGA-LLVKDONJSA-N |
| XLogP | 3.34 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|