C24H19N3O2 — CID 59543297
N-[2-(1-methylindol-6-yl)-3-oxo-1H-isoindol-5-yl]benzamide (PubChem CID 59543297) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-[2-(1-methylindol-6-yl)-3-oxo-1H-isoindol-5-yl]benzamide.
| Compound Name | N-[2-(1-methylindol-6-yl)-3-oxo-1H-isoindol-5-yl]benzamide |
|---|---|
| PubChem CID | 59543297 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-[2-(1-methylindol-6-yl)-3-oxo-1H-isoindol-5-yl]benzamide |
| SMILES | Cn1ccc2ccc(N3Cc4ccc(NC(=O)c5ccccc5)cc4C3=O)cc21 |
| InChI | InChI=1S/C24H19N3O2/c1-26-12-11-16-8-10-20(14-22(16)26)27-15-18-7-9-19(13-21(18)24(27)29)25-23(28)17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H,25,28) |
| InChIKey | VFDMWVUJEODDRJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |