C17H16F3N3O4S — CID 59543583
(2S,4R)-N-(1-cyanocyclopropyl)-1-formyl-4-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxamide (PubChem CID 59543583) has the molecular formula C17H16F3N3O4S and a molecular weight of 415.39 g/mol. Its IUPAC name is (2S,4R)-N-(1-cyanocyclopropyl)-1-formyl-4-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-(1-cyanocyclopropyl)-1-formyl-4-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59543583 |
| Molecular Formula | C17H16F3N3O4S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | (2S,4R)-N-(1-cyanocyclopropyl)-1-formyl-4-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxamide |
| SMILES | N#CC1(NC(=O)[C@@H]2C[C@@H](S(=O)(=O)c3ccccc3C(F)(F)F)CN2C=O)CC1 |
| InChI | InChI=1S/C17H16F3N3O4S/c18-17(19,20)12-3-1-2-4-14(12)28(26,27)11-7-13(23(8-11)10-24)15(25)22-16(9-21)5-6-16/h1-4,10-11,13H,5-8H2,(H,22,25)/t11-,13+/m1/s1 |
| InChIKey | JILQFLUJFOCZIX-YPMHNXCESA-N |
| XLogP | 1.25 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|