C21H18Cl2N4O5S — CID 59543832
(2S,4R)-N-(1-cyanocyclopropyl)-4-(2,4-dichlorophenyl)sulfonyl-1-(2-nitrophenyl)pyrrolidine-2-carboxamide (PubChem CID 59543832) has the molecular formula C21H18Cl2N4O5S and a molecular weight of 509.37 g/mol. Its IUPAC name is (2S,4R)-N-(1-cyanocyclopropyl)-4-(2,4-dichlorophenyl)sulfonyl-1-(2-nitrophenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-(1-cyanocyclopropyl)-4-(2,4-dichlorophenyl)sulfonyl-1-(2-nitrophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59543832 |
| Molecular Formula | C21H18Cl2N4O5S |
| Molecular Weight | 509.37 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | (2S,4R)-N-(1-cyanocyclopropyl)-4-(2,4-dichlorophenyl)sulfonyl-1-(2-nitrophenyl)pyrrolidine-2-carboxamide |
| SMILES | N#CC1(NC(=O)[C@@H]2C[C@@H](S(=O)(=O)c3ccc(Cl)cc3Cl)CN2c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H18Cl2N4O5S/c22-13-5-6-19(15(23)9-13)33(31,32)14-10-18(20(28)25-21(12-24)7-8-21)26(11-14)16-3-1-2-4-17(16)27(29)30/h1-6,9,14,18H,7-8,10-11H2,(H,25,28)/t14-,18+/m1/s1 |
| InChIKey | KVYICVQIGPZMGO-KDOFPFPSSA-N |
| XLogP | 3.50 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|