About (3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine
(3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine (PubChem CID 59543856) has the molecular formula C13H17BrFNO
and a molecular weight of 302.19 g/mol. Its IUPAC name is (3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine.
Molecular Properties
| Compound Name | (3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine |
| PubChem CID | 59543856 |
| Molecular Formula | C13H17BrFNO |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | (3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine |
| SMILES | C[C@H]1COC[C@H](C)N1Cc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C13H17BrFNO/c1-9-7-17-8-10(2)16(9)6-11-3-4-12(14)13(15)5-11/h3-5,9-10H,6-8H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | UKXZLWREBIGTJT-UWVGGRQHSA-N |
| XLogP | 3.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine?
The IUPAC name of (3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine (CID 59543856) is (3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine.
What is the SMILES notation for (3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine?
The canonical SMILES for (3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine is C[C@H]1COC[C@H](C)N1Cc1ccc(Br)c(F)c1.
What is the InChIKey of (3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine?
The InChIKey is UKXZLWREBIGTJT-UWVGGRQHSA-N. The full InChI is InChI=1S/C13H17BrFNO/c1-9-7-17-8-10(2)16(9)6-11-3-4-12(14)13(15)5-11/h3-5,9-10H,6-8H2,1-2H3/t9-,10-/m0/s1.
What are the key properties of (3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine?
(3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine has a molecular weight of 302.19 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-4-[(4-bromo-3-fluorophenyl)methyl]-3,5-dimethylmorpholine is sourced from PubChem (CID 59543856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).