C22H26O6 — CID 59544272
3-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2,6-dimethoxyphenyl]-2-methylbenzaldehyde (PubChem CID 59544272) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is 3-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2,6-dimethoxyphenyl]-2-methylbenzaldehyde.
| Compound Name | 3-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2,6-dimethoxyphenyl]-2-methylbenzaldehyde |
|---|---|
| PubChem CID | 59544272 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2,6-dimethoxyphenyl]-2-methylbenzaldehyde |
| SMILES | COc1cc(OC[C@H]2COC(C)(C)O2)cc(OC)c1-c1cccc(C=O)c1C |
| InChI | InChI=1S/C22H26O6/c1-14-15(11-23)7-6-8-18(14)21-19(24-4)9-16(10-20(21)25-5)26-12-17-13-27-22(2,3)28-17/h6-11,17H,12-13H2,1-5H3/t17-/m0/s1 |
| InChIKey | PMIHSXHNURNMLC-KRWDZBQOSA-N |
| XLogP | 4.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|