About pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate
pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate (PubChem CID 59544696) has the molecular formula C24H24N4O3S
and a molecular weight of 448.55 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate.
Molecular Properties
| Compound Name | pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate |
| PubChem CID | 59544696 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate |
| SMILES | O=C(N[C@]1(c2ccc(C(=O)Nc3ccccc3S)cc2)CCNC1)OCc1cccnc1 |
| InChI | InChI=1S/C24H24N4O3S/c29-22(27-20-5-1-2-6-21(20)32)18-7-9-19(10-8-18)24(11-13-26-16-24)28-23(30)31-15-17-4-3-12-25-14-17/h1-10,12,14,26,32H,11,13,15-16H2,(H,27,29)(H,28,30)/t24-/m1/s1 |
| InChIKey | YUYPYQLPSHYMJF-XMMPIXPASA-N |
| XLogP | 3.74 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate?
The IUPAC name of pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate (CID 59544696) is pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate.
What is the SMILES notation for pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate?
The canonical SMILES for pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate is O=C(N[C@]1(c2ccc(C(=O)Nc3ccccc3S)cc2)CCNC1)OCc1cccnc1.
What is the InChIKey of pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate?
The InChIKey is YUYPYQLPSHYMJF-XMMPIXPASA-N. The full InChI is InChI=1S/C24H24N4O3S/c29-22(27-20-5-1-2-6-21(20)32)18-7-9-19(10-8-18)24(11-13-26-16-24)28-23(30)31-15-17-4-3-12-25-14-17/h1-10,12,14,26,32H,11,13,15-16H2,(H,27,29)(H,28,30)/t24-/m1/s1.
What are the key properties of pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate?
pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate has a molecular weight of 448.55 g/mol, XLogP of 3.74, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-ylmethyl N-[(3S)-3-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]pyrrolidin-3-yl]carbamate is sourced from PubChem (CID 59544696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).