About 5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole
5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 59544914) has the molecular formula C16H14FNO
and a molecular weight of 255.29 g/mol. Its IUPAC name is 5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole |
| PubChem CID | 59544914 |
| Molecular Formula | C16H14FNO |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | Fc1ccc(C2=NOC(Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C16H14FNO/c17-14-8-6-13(7-9-14)16-11-15(19-18-16)10-12-4-2-1-3-5-12/h1-9,15H,10-11H2 |
| InChIKey | VJUFXEQLCPXMHG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole?
The IUPAC name of 5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole (CID 59544914) is 5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole is Fc1ccc(C2=NOC(Cc3ccccc3)C2)cc1.
What is the InChIKey of 5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole?
The InChIKey is VJUFXEQLCPXMHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO/c17-14-8-6-13(7-9-14)16-11-15(19-18-16)10-12-4-2-1-3-5-12/h1-9,15H,10-11H2.
What are the key properties of 5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole?
5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole has a molecular weight of 255.29 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 59544914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).